C19H17F3N4O2 — CID 123885552
1-(3-imidazol-1-ylpropyl)-4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrrolidine-2,3-dione (PubChem CID 123885552) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123885552 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCn2ccnc2)C(C(F)(F)F)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17F3N4O2/c20-19(21,22)17-15(13-10-24-14-5-2-1-4-12(13)14)16(27)18(28)26(17)8-3-7-25-9-6-23-11-25/h1-2,4-6,9-11,15,17,24H,3,7-8H2 |
| InChIKey | RJYSFLXHYIJEJW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|