C20H22N4O4 — CID 123587198
5-(1,2-dihydroxyethyl)-1-(3-imidazol-1-ylpropyl)-4-(1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 123587198) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-(1,2-dihydroxyethyl)-1-(3-imidazol-1-ylpropyl)-4-(1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | 5-(1,2-dihydroxyethyl)-1-(3-imidazol-1-ylpropyl)-4-(1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123587198 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 5-(1,2-dihydroxyethyl)-1-(3-imidazol-1-ylpropyl)-4-(1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCn2ccnc2)C(C(O)CO)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H22N4O4/c25-11-16(26)18-17(14-10-22-15-5-2-1-4-13(14)15)19(27)20(28)24(18)8-3-7-23-9-6-21-12-23/h1-2,4-6,9-10,12,16-18,22,25-26H,3,7-8,11H2 |
| InChIKey | RTIYWFPHXIQGAM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|