C24H23F2N3O — CID 123435419
N-(3-cyclohexyl-5-phenylpyrazin-2-yl)-2-(3,4-difluorophenyl)acetamide (PubChem CID 123435419) has the molecular formula C24H23F2N3O and a molecular weight of 407.46 g/mol. Its IUPAC name is N-(3-cyclohexyl-5-phenylpyrazin-2-yl)-2-(3,4-difluorophenyl)acetamide.
| Compound Name | N-(3-cyclohexyl-5-phenylpyrazin-2-yl)-2-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 123435419 |
| Molecular Formula | C24H23F2N3O |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-(3-cyclohexyl-5-phenylpyrazin-2-yl)-2-(3,4-difluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)c(F)c1)Nc1ncc(-c2ccccc2)nc1C1CCCCC1 |
| InChI | InChI=1S/C24H23F2N3O/c25-19-12-11-16(13-20(19)26)14-22(30)29-24-23(18-9-5-2-6-10-18)28-21(15-27-24)17-7-3-1-4-8-17/h1,3-4,7-8,11-13,15,18H,2,5-6,9-10,14H2,(H,27,29,30) |
| InChIKey | YVNRQGATBOCOIN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |