C22H17ClF2IN3O3 — CID 123437557
3-[[5-[2-[(3-chloro-4-iodoanilino)methyl]-4,5-difluorophenyl]pyridine-2-carbonyl]amino]propanoic acid (PubChem CID 123437557) has the molecular formula C22H17ClF2IN3O3 and a molecular weight of 571.75 g/mol. Its IUPAC name is 3-[[5-[2-[(3-chloro-4-iodoanilino)methyl]-4,5-difluorophenyl]pyridine-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[5-[2-[(3-chloro-4-iodoanilino)methyl]-4,5-difluorophenyl]pyridine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 123437557 |
| Molecular Formula | C22H17ClF2IN3O3 |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.00 |
| IUPAC Name | 3-[[5-[2-[(3-chloro-4-iodoanilino)methyl]-4,5-difluorophenyl]pyridine-2-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(-c2cc(F)c(F)cc2CNc2ccc(I)c(Cl)c2)cn1 |
| InChI | InChI=1S/C22H17ClF2IN3O3/c23-16-8-14(2-3-19(16)26)28-11-13-7-17(24)18(25)9-15(13)12-1-4-20(29-10-12)22(32)27-6-5-21(30)31/h1-4,7-10,28H,5-6,11H2,(H,27,32)(H,30,31) |
| InChIKey | XIMMZCVENSUJDL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|