C19H13ClF2IN3O — CID 141349561
5-[2-[(3-chloro-4-iodoanilino)methyl]-4,5-difluorophenyl]pyridine-2-carboxamide (PubChem CID 141349561) has the molecular formula C19H13ClF2IN3O and a molecular weight of 499.69 g/mol. Its IUPAC name is 5-[2-[(3-chloro-4-iodoanilino)methyl]-4,5-difluorophenyl]pyridine-2-carboxamide.
| Compound Name | 5-[2-[(3-chloro-4-iodoanilino)methyl]-4,5-difluorophenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 141349561 |
| Molecular Formula | C19H13ClF2IN3O |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 498.98 |
| IUPAC Name | 5-[2-[(3-chloro-4-iodoanilino)methyl]-4,5-difluorophenyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(-c2cc(F)c(F)cc2CNc2ccc(I)c(Cl)c2)cn1 |
| InChI | InChI=1S/C19H13ClF2IN3O/c20-14-6-12(2-3-17(14)23)25-9-11-5-15(21)16(22)7-13(11)10-1-4-18(19(24)27)26-8-10/h1-8,25H,9H2,(H2,24,27) |
| InChIKey | COKSUBZBKXDNKA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|