About 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium
2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium (PubChem CID 123437847) has the molecular formula C18H22N+
and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium.
Molecular Properties
| Compound Name | 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium |
| PubChem CID | 123437847 |
| Molecular Formula | C18H22N+ |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium |
| SMILES | CC1Cc2ccccc2-c2cc(C(C)(C)C)cc[n+]21 |
| InChI | InChI=1S/C18H22N/c1-13-11-14-7-5-6-8-16(14)17-12-15(18(2,3)4)9-10-19(13)17/h5-10,12-13H,11H2,1-4H3/q+1 |
| InChIKey | YFSKDKDFCZHVIX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium?
The IUPAC name of 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium (CID 123437847) is 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium.
What is the SMILES notation for 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium?
The canonical SMILES for 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium is CC1Cc2ccccc2-c2cc(C(C)(C)C)cc[n+]21.
What is the InChIKey of 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium?
The InChIKey is YFSKDKDFCZHVIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N/c1-13-11-14-7-5-6-8-16(14)17-12-15(18(2,3)4)9-10-19(13)17/h5-10,12-13H,11H2,1-4H3/q+1.
What are the key properties of 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium?
2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium has a molecular weight of 252.38 g/mol, XLogP of 4.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-methyl-6,7-dihydrobenzo[a]quinolizin-5-ium is sourced from PubChem (CID 123437847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).