C15H24N2O3 — CID 123438757
ethyl 4-methyl-6-(2-methylhex-5-enyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 123438757) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is ethyl 4-methyl-6-(2-methylhex-5-enyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-methyl-6-(2-methylhex-5-enyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 123438757 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | ethyl 4-methyl-6-(2-methylhex-5-enyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | C=CCCC(C)CC1NC(=O)N=C(C)C1C(=O)OCC |
| InChI | InChI=1S/C15H24N2O3/c1-5-7-8-10(3)9-12-13(14(18)20-6-2)11(4)16-15(19)17-12/h5,10,12-13H,1,6-9H2,2-4H3,(H,17,19) |
| InChIKey | YNDDQTSXZBKBSM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|