C23H21FN4O6 — CID 123438813
methyl 4-[[[6-[(4-fluoro-3-methylphenyl)methylcarbamoyl]pyrimidine-4-carbonyl]amino]-dihydroxymethyl]benzoate (PubChem CID 123438813) has the molecular formula C23H21FN4O6 and a molecular weight of 468.44 g/mol. Its IUPAC name is methyl 4-[[[6-[(4-fluoro-3-methylphenyl)methylcarbamoyl]pyrimidine-4-carbonyl]amino]-dihydroxymethyl]benzoate.
| Compound Name | methyl 4-[[[6-[(4-fluoro-3-methylphenyl)methylcarbamoyl]pyrimidine-4-carbonyl]amino]-dihydroxymethyl]benzoate |
|---|---|
| PubChem CID | 123438813 |
| Molecular Formula | C23H21FN4O6 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | methyl 4-[[[6-[(4-fluoro-3-methylphenyl)methylcarbamoyl]pyrimidine-4-carbonyl]amino]-dihydroxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(C(O)(O)NC(=O)c2cc(C(=O)NCc3ccc(F)c(C)c3)ncn2)cc1 |
| InChI | InChI=1S/C23H21FN4O6/c1-13-9-14(3-8-17(13)24)11-25-20(29)18-10-19(27-12-26-18)21(30)28-23(32,33)16-6-4-15(5-7-16)22(31)34-2/h3-10,12,32-33H,11H2,1-2H3,(H,25,29)(H,28,30) |
| InChIKey | NZHWQMSNZJMJDL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 150.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|