C14H17F3OS — CID 123439070
1-[1-(methylsulfanyloxymethyl)cyclopentyl]-4-(trifluoromethyl)benzene (PubChem CID 123439070) has the molecular formula C14H17F3OS and a molecular weight of 290.35 g/mol. Its IUPAC name is 1-[1-(methylsulfanyloxymethyl)cyclopentyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[1-(methylsulfanyloxymethyl)cyclopentyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 123439070 |
| Molecular Formula | C14H17F3OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-[1-(methylsulfanyloxymethyl)cyclopentyl]-4-(trifluoromethyl)benzene |
| SMILES | CSOCC1(c2ccc(C(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C14H17F3OS/c1-19-18-10-13(8-2-3-9-13)11-4-6-12(7-5-11)14(15,16)17/h4-7H,2-3,8-10H2,1H3 |
| InChIKey | WWXVLTNBEQABJT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|