C15H20F3N — CID 79834999
2,2-dimethyl-1-[4-(trifluoromethyl)phenyl]cyclohexan-1-amine (PubChem CID 79834999) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-(trifluoromethyl)phenyl]cyclohexan-1-amine.
| Compound Name | 2,2-dimethyl-1-[4-(trifluoromethyl)phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 79834999 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2,2-dimethyl-1-[4-(trifluoromethyl)phenyl]cyclohexan-1-amine |
| SMILES | CC1(C)CCCCC1(N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3N/c1-13(2)9-3-4-10-14(13,19)11-5-7-12(8-6-11)15(16,17)18/h5-8H,3-4,9-10,19H2,1-2H3 |
| InChIKey | DNYASYSAKJXGHM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |