C52H61FO6SSi — CID 123439089
tert-butyl-[2-[1-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-1-methoxy-2,3,4-tris(phenylmethoxy)butoxy]ethoxy]-dimethylsilane (PubChem CID 123439089) has the molecular formula C52H61FO6SSi and a molecular weight of 861.21 g/mol. Its IUPAC name is tert-butyl-[2-[1-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-1-methoxy-2,3,4-tris(phenylmethoxy)butoxy]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[1-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-1-methoxy-2,3,4-tris(phenylmethoxy)butoxy]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 123439089 |
| Molecular Formula | C52H61FO6SSi |
| Molecular Weight | 861.21 g/mol |
| Exact Mass | 860.39 |
| IUPAC Name | tert-butyl-[2-[1-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-1-methoxy-2,3,4-tris(phenylmethoxy)butoxy]ethoxy]-dimethylsilane |
| SMILES | COC(OCCO[Si](C)(C)C(C)(C)C)(c1ccc(C)c(Cc2ccc(-c3ccc(F)cc3)s2)c1)C(OCc1ccccc1)C(COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C52H61FO6SSi/c1-39-23-26-45(33-44(39)34-47-29-30-49(60-47)43-24-27-46(53)28-25-43)52(54-5,58-31-32-59-61(6,7)51(2,3)4)50(57-37-42-21-15-10-16-22-42)48(56-36-41-19-13-9-14-20-41)38-55-35-40-17-11-8-12-18-40/h8-30,33,48,50H,31-32,34-38H2,1-7H3 |
| InChIKey | DCKONOSGPWOZDQ-UHFFFAOYSA-N |
| XLogP | 12.68 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.21 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|