C55H44 — CID 123439239
2,7-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-4-naphthalen-2-ylfluorene (PubChem CID 123439239) has the molecular formula C55H44 and a molecular weight of 704.96 g/mol. Its IUPAC name is 2,7-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-4-naphthalen-2-ylfluorene.
| Compound Name | 2,7-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-4-naphthalen-2-ylfluorene |
|---|---|
| PubChem CID | 123439239 |
| Molecular Formula | C55H44 |
| Molecular Weight | 704.96 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | 2,7-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-4-naphthalen-2-ylfluorene |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc(-c5ccc6ccccc6c5)c3-4)cc21 |
| InChI | InChI=1S/C55H44/c1-53(2)46-17-11-9-15-40(46)42-24-21-35(29-48(42)53)36-23-26-44-50(30-36)55(5,6)51-32-39(28-45(52(44)51)38-20-19-33-13-7-8-14-34(33)27-38)37-22-25-43-41-16-10-12-18-47(41)54(3,4)49(43)31-37/h7-32H,1-6H3 |
| InChIKey | NJMBPOFOEIGMEO-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.96 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |