C11H12N2 — CID 123439244
(9Z)-7-methyl-3,10a-dihydropyrido[2,3-d]azocine (PubChem CID 123439244) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is (9Z)-7-methyl-3,10a-dihydropyrido[2,3-d]azocine.
| Compound Name | (9Z)-7-methyl-3,10a-dihydropyrido[2,3-d]azocine |
|---|---|
| PubChem CID | 123439244 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (9Z)-7-methyl-3,10a-dihydropyrido[2,3-d]azocine |
| SMILES | C/C1=N/C=C\C2N=CCC=C2C=C1 |
| InChI | InChI=1S/C11H12N2/c1-9-4-5-10-3-2-7-13-11(10)6-8-12-9/h3-8,11H,2H2,1H3/b5-4?,8-6-,12-9- |
| InChIKey | JGHGAYVKMHQCGJ-JYJBXAJISA-N |
| XLogP | 2.30 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |