C8H10N2O — CID 123439367
N-(2H-azepin-6-yl)acetamide (PubChem CID 123439367) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is N-(2H-azepin-6-yl)acetamide.
| Compound Name | N-(2H-azepin-6-yl)acetamide |
|---|---|
| PubChem CID | 123439367 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | N-(2H-azepin-6-yl)acetamide |
| SMILES | CC(=O)NC1=CC=CCN=C1 |
| InChI | InChI=1S/C8H10N2O/c1-7(11)10-8-4-2-3-5-9-6-8/h2-4,6H,5H2,1H3,(H,10,11) |
| InChIKey | CHIAHFYFOHFTRI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |