About 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole
5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole (PubChem CID 123439565) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole.
Molecular Properties
| Compound Name | 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole |
| PubChem CID | 123439565 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole |
| SMILES | CC1=CC(c2ncc(C)[nH]2)NC1 |
| InChI | InChI=1S/C9H13N3/c1-6-3-8(10-4-6)9-11-5-7(2)12-9/h3,5,8,10H,4H2,1-2H3,(H,11,12) |
| InChIKey | OJHSWTAGLGWIFF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole?
The IUPAC name of 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole (CID 123439565) is 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole.
What is the SMILES notation for 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole?
The canonical SMILES for 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole is CC1=CC(c2ncc(C)[nH]2)NC1.
What is the InChIKey of 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole?
The InChIKey is OJHSWTAGLGWIFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-6-3-8(10-4-6)9-11-5-7(2)12-9/h3,5,8,10H,4H2,1-2H3,(H,11,12).
What are the key properties of 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole?
5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole has a molecular weight of 163.22 g/mol, XLogP of 1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole is sourced from PubChem (CID 123439565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).