C9H13N3 — CID 123439565
5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole (PubChem CID 123439565) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole.
| Compound Name | 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole |
|---|---|
| PubChem CID | 123439565 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5-methyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole |
| SMILES | CC1=CC(c2ncc(C)[nH]2)NC1 |
| InChI | InChI=1S/C9H13N3/c1-6-3-8(10-4-6)9-11-5-7(2)12-9/h3,5,8,10H,4H2,1-2H3,(H,11,12) |
| InChIKey | OJHSWTAGLGWIFF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|