5-methylhexanoic acid

C7H14O2 — CID 12344

IUPAC5-methylhexanoic acid
SMILESCC(C)CCCC(=O)O
InChIInChI=1S/C7H14O2/c1-6(2)4-3-5-7(8)9/h6H,3-5H2,1-2H3,(H,8,9)
InChIKeyMHPUGCYGQWGLJL-UHFFFAOYSA-N
MW130.19 g/mol
LogP1.90
Rot. Bonds4

About 5-methylhexanoic acid

5-methylhexanoic acid (PubChem CID 12344) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is 5-methylhexanoic acid.

Molecular Properties

Compound Name5-methylhexanoic acid
PubChem CID12344
Molecular FormulaC7H14O2
Molecular Weight130.19 g/mol
Exact Mass130.10
IUPAC Name5-methylhexanoic acid
SMILESCC(C)CCCC(=O)O
InChIInChI=1S/C7H14O2/c1-6(2)4-3-5-7(8)9/h6H,3-5H2,1-2H3,(H,8,9)
InChIKeyMHPUGCYGQWGLJL-UHFFFAOYSA-N
XLogP1.90
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.19
LogP ≤ 51.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 5-methylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methylhexanoic acid?
The IUPAC name of 5-methylhexanoic acid (CID 12344) is 5-methylhexanoic acid.
What is the SMILES notation for 5-methylhexanoic acid?
The canonical SMILES for 5-methylhexanoic acid is CC(C)CCCC(=O)O.
What is the InChIKey of 5-methylhexanoic acid?
The InChIKey is MHPUGCYGQWGLJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-6(2)4-3-5-7(8)9/h6H,3-5H2,1-2H3,(H,8,9).
What are the key properties of 5-methylhexanoic acid?
5-methylhexanoic acid has a molecular weight of 130.19 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexanoic acid is sourced from PubChem (CID 12344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).