C34H44N4O — CID 123440112
2-[4-(4-ethylcyclohexyl)oxybenzenecarboximidoyl]-4-[[(1-pyridin-3-ylcyclohexyl)methylamino]methyl]aniline (PubChem CID 123440112) has the molecular formula C34H44N4O and a molecular weight of 524.75 g/mol. Its IUPAC name is 2-[4-(4-ethylcyclohexyl)oxybenzenecarboximidoyl]-4-[[(1-pyridin-3-ylcyclohexyl)methylamino]methyl]aniline.
| Compound Name | 2-[4-(4-ethylcyclohexyl)oxybenzenecarboximidoyl]-4-[[(1-pyridin-3-ylcyclohexyl)methylamino]methyl]aniline |
|---|---|
| PubChem CID | 123440112 |
| Molecular Formula | C34H44N4O |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | 2-[4-(4-ethylcyclohexyl)oxybenzenecarboximidoyl]-4-[[(1-pyridin-3-ylcyclohexyl)methylamino]methyl]aniline |
| SMILES | [H]/N=C(\c1ccc(OC2CCC(CC)CC2)cc1)c1cc(CNCC2(c3cccnc3)CCCCC2)ccc1N |
| InChI | InChI=1S/C34H44N4O/c1-2-25-8-13-29(14-9-25)39-30-15-11-27(12-16-30)33(36)31-21-26(10-17-32(31)35)22-38-24-34(18-4-3-5-19-34)28-7-6-20-37-23-28/h6-7,10-12,15-17,20-21,23,25,29,36,38H,2-5,8-9,13-14,18-19,22,24,35H2,1H3/b36-33+ |
| InChIKey | RMIYTFBUNJJULU-PKUSAGTQSA-N |
| XLogP | 7.42 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|