C22H26ClF3N4O3 — CID 123441722
tert-butyl 3-carbamoyl-2-(3-chloro-4-fluorophenyl)-9,9-difluoro-4,6,7,8,10,11-hexahydropyrazolo[1,5-a][1,4]diazecine-5-carboxylate (PubChem CID 123441722) has the molecular formula C22H26ClF3N4O3 and a molecular weight of 486.92 g/mol. Its IUPAC name is tert-butyl 3-carbamoyl-2-(3-chloro-4-fluorophenyl)-9,9-difluoro-4,6,7,8,10,11-hexahydropyrazolo[1,5-a][1,4]diazecine-5-carboxylate.
| Compound Name | tert-butyl 3-carbamoyl-2-(3-chloro-4-fluorophenyl)-9,9-difluoro-4,6,7,8,10,11-hexahydropyrazolo[1,5-a][1,4]diazecine-5-carboxylate |
|---|---|
| PubChem CID | 123441722 |
| Molecular Formula | C22H26ClF3N4O3 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | tert-butyl 3-carbamoyl-2-(3-chloro-4-fluorophenyl)-9,9-difluoro-4,6,7,8,10,11-hexahydropyrazolo[1,5-a][1,4]diazecine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(F)(F)CCn2nc(-c3ccc(F)c(Cl)c3)c(C(N)=O)c2C1 |
| InChI | InChI=1S/C22H26ClF3N4O3/c1-21(2,3)33-20(32)29-9-4-7-22(25,26)8-10-30-16(12-29)17(19(27)31)18(28-30)13-5-6-15(24)14(23)11-13/h5-6,11H,4,7-10,12H2,1-3H3,(H2,27,31) |
| InChIKey | ABQJFNFCKYWWLX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |