C33H44BN3O2 — CID 123441729
2-[4-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-2,5-dihydro-1H-imidazol-2-yl]piperidine (PubChem CID 123441729) has the molecular formula C33H44BN3O2 and a molecular weight of 525.55 g/mol. Its IUPAC name is 2-[4-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-2,5-dihydro-1H-imidazol-2-yl]piperidine.
| Compound Name | 2-[4-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-2,5-dihydro-1H-imidazol-2-yl]piperidine |
|---|---|
| PubChem CID | 123441729 |
| Molecular Formula | C33H44BN3O2 |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.35 |
| IUPAC Name | 2-[4-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-2,5-dihydro-1H-imidazol-2-yl]piperidine |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(C4=NC(C5CCCCN5)NC4)cc3)c3c2CCC32CCCC2)OC1(C)C |
| InChI | InChI=1S/C33H44BN3O2/c1-31(2)32(3,4)39-34(38-31)26-15-14-24(29-25(26)16-19-33(29)17-6-7-18-33)22-10-12-23(13-11-22)28-21-36-30(37-28)27-9-5-8-20-35-27/h10-15,27,30,35-36H,5-9,16-21H2,1-4H3 |
| InChIKey | YUUYIZIYTUNMBS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|