C37H49BN2O2 — CID 123967415
5-methyl-2-(4-methylpyrrolidin-2-yl)-6-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-4,5-dihydro-3H-azepine (PubChem CID 123967415) has the molecular formula C37H49BN2O2 and a molecular weight of 564.62 g/mol. Its IUPAC name is 5-methyl-2-(4-methylpyrrolidin-2-yl)-6-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-4,5-dihydro-3H-azepine.
| Compound Name | 5-methyl-2-(4-methylpyrrolidin-2-yl)-6-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-4,5-dihydro-3H-azepine |
|---|---|
| PubChem CID | 123967415 |
| Molecular Formula | C37H49BN2O2 |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | 5-methyl-2-(4-methylpyrrolidin-2-yl)-6-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-4,5-dihydro-3H-azepine |
| SMILES | CC1CNC(C2=NC=C(c3ccc(-c4ccc(B5OC(C)(C)C(C)(C)O5)c5c4C4(CCCC4)CC5)cc3)C(C)CC2)C1 |
| InChI | InChI=1S/C37H49BN2O2/c1-24-21-33(39-22-24)32-16-9-25(2)30(23-40-32)27-12-10-26(11-13-27)28-14-15-31(38-41-35(3,4)36(5,6)42-38)29-17-20-37(34(28)29)18-7-8-19-37/h10-15,23-25,33,39H,7-9,16-22H2,1-6H3 |
| InChIKey | ZDMZCUGUIGTVLV-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|