C11H17N — CID 123443471
N-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-imine (PubChem CID 123443471) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-imine.
| Compound Name | N-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-imine |
|---|---|
| PubChem CID | 123443471 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-imine |
| SMILES | C/N=C1/C=C2CCCCC2CC1 |
| InChI | InChI=1S/C11H17N/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h8-9H,2-7H2,1H3/b12-11+ |
| InChIKey | JKKDSVPOXPIXRZ-VAWYXSNFSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|