C27H35NO4 — CID 123444277
methyl N-[1-[4-[[4-[(4-propan-2-yloxyphenyl)methyl]cyclohexylidene]methoxy]phenyl]ethyl]carbamate (PubChem CID 123444277) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is methyl N-[1-[4-[[4-[(4-propan-2-yloxyphenyl)methyl]cyclohexylidene]methoxy]phenyl]ethyl]carbamate.
| Compound Name | methyl N-[1-[4-[[4-[(4-propan-2-yloxyphenyl)methyl]cyclohexylidene]methoxy]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 123444277 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | methyl N-[1-[4-[[4-[(4-propan-2-yloxyphenyl)methyl]cyclohexylidene]methoxy]phenyl]ethyl]carbamate |
| SMILES | COC(=O)NC(C)c1ccc(OC=C2CCC(Cc3ccc(OC(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H35NO4/c1-19(2)32-26-13-9-22(10-14-26)17-21-5-7-23(8-6-21)18-31-25-15-11-24(12-16-25)20(3)28-27(29)30-4/h9-16,18-21H,5-8,17H2,1-4H3,(H,28,29)/b23-18- |
| InChIKey | PGZRJVNWNPATJT-NKFKGCMQSA-N |
| XLogP | 6.59 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|