C25H31NO3 — CID 145042939
methyl 7-[[4-[(1S)-1-acetamidoethyl]phenyl]methyl]-5,6,7,8,9,10-hexahydrobenzo[8]annulene-1-carboxylate (PubChem CID 145042939) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is methyl 7-[[4-[(1S)-1-acetamidoethyl]phenyl]methyl]-5,6,7,8,9,10-hexahydrobenzo[8]annulene-1-carboxylate.
| Compound Name | methyl 7-[[4-[(1S)-1-acetamidoethyl]phenyl]methyl]-5,6,7,8,9,10-hexahydrobenzo[8]annulene-1-carboxylate |
|---|---|
| PubChem CID | 145042939 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | methyl 7-[[4-[(1S)-1-acetamidoethyl]phenyl]methyl]-5,6,7,8,9,10-hexahydrobenzo[8]annulene-1-carboxylate |
| SMILES | COC(=O)c1cccc2c1CCCC(Cc1ccc([C@H](C)NC(C)=O)cc1)CC2 |
| InChI | InChI=1S/C25H31NO3/c1-17(26-18(2)27)21-13-10-20(11-14-21)16-19-6-4-8-23-22(15-12-19)7-5-9-24(23)25(28)29-3/h5,7,9-11,13-14,17,19H,4,6,8,12,15-16H2,1-3H3,(H,26,27)/t17-,19?/m0/s1 |
| InChIKey | DGGWHAPXJLCHNJ-KKFHFHRHSA-N |
| XLogP | 4.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |