C20H21N3O — CID 162016935
N-[(1S)-1-[4-[2-[2-(cyclopropylmethyl)pyrimidin-5-yl]ethynyl]phenyl]ethyl]acetamide (PubChem CID 162016935) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[(1S)-1-[4-[2-[2-(cyclopropylmethyl)pyrimidin-5-yl]ethynyl]phenyl]ethyl]acetamide.
| Compound Name | N-[(1S)-1-[4-[2-[2-(cyclopropylmethyl)pyrimidin-5-yl]ethynyl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 162016935 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-[(1S)-1-[4-[2-[2-(cyclopropylmethyl)pyrimidin-5-yl]ethynyl]phenyl]ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C)c1ccc(C#Cc2cnc(CC3CC3)nc2)cc1 |
| InChI | InChI=1S/C20H21N3O/c1-14(23-15(2)24)19-9-7-16(8-10-19)3-6-18-12-21-20(22-13-18)11-17-4-5-17/h7-10,12-14,17H,4-5,11H2,1-2H3,(H,23,24)/t14-/m0/s1 |
| InChIKey | YUFPHPDUNPJJNZ-AWEZNQCLSA-N |
| XLogP | 3.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|