C6H7F2N — CID 123445255
3,5-difluoro-6-methyl-3,4-dihydropyridine (PubChem CID 123445255) has the molecular formula C6H7F2N and a molecular weight of 131.12 g/mol. Its IUPAC name is 3,5-difluoro-6-methyl-3,4-dihydropyridine.
| Compound Name | 3,5-difluoro-6-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 123445255 |
| Molecular Formula | C6H7F2N |
| Molecular Weight | 131.12 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 3,5-difluoro-6-methyl-3,4-dihydropyridine |
| SMILES | CC1=C(F)CC(F)C=N1 |
| InChI | InChI=1S/C6H7F2N/c1-4-6(8)2-5(7)3-9-4/h3,5H,2H2,1H3 |
| InChIKey | NOPFVJQOFSDUAN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.12 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |