C7H10FN — CID 143491679
6-ethyl-4-fluoro-3,4-dihydropyridine (PubChem CID 143491679) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is 6-ethyl-4-fluoro-3,4-dihydropyridine.
| Compound Name | 6-ethyl-4-fluoro-3,4-dihydropyridine |
|---|---|
| PubChem CID | 143491679 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 6-ethyl-4-fluoro-3,4-dihydropyridine |
| SMILES | CCC1=CC(F)CC=N1 |
| InChI | InChI=1S/C7H10FN/c1-2-7-5-6(8)3-4-9-7/h4-6H,2-3H2,1H3 |
| InChIKey | IQQVGYKCJNCYTI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |