C7H10FN — CID 134593926
3-fluoro-2,6-dimethyl-3,4-dihydropyridine (PubChem CID 134593926) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is 3-fluoro-2,6-dimethyl-3,4-dihydropyridine.
| Compound Name | 3-fluoro-2,6-dimethyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 134593926 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 3-fluoro-2,6-dimethyl-3,4-dihydropyridine |
| SMILES | CC1=CCC(F)C(C)=N1 |
| InChI | InChI=1S/C7H10FN/c1-5-3-4-7(8)6(2)9-5/h3,7H,4H2,1-2H3 |
| InChIKey | XBLUBMVSQDYIID-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |