C30H52N2O3 — CID 123446432
4-methylhexyl 5-[2-[N-(2-ethenyl-1-methylcyclopropyl)-C-methylcarbonimidoyl]pyrrolidine-1-carbonyl]-4,6,6-trimethylheptanoate (PubChem CID 123446432) has the molecular formula C30H52N2O3 and a molecular weight of 488.76 g/mol. Its IUPAC name is 4-methylhexyl 5-[2-[N-(2-ethenyl-1-methylcyclopropyl)-C-methylcarbonimidoyl]pyrrolidine-1-carbonyl]-4,6,6-trimethylheptanoate.
| Compound Name | 4-methylhexyl 5-[2-[N-(2-ethenyl-1-methylcyclopropyl)-C-methylcarbonimidoyl]pyrrolidine-1-carbonyl]-4,6,6-trimethylheptanoate |
|---|---|
| PubChem CID | 123446432 |
| Molecular Formula | C30H52N2O3 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.40 |
| IUPAC Name | 4-methylhexyl 5-[2-[N-(2-ethenyl-1-methylcyclopropyl)-C-methylcarbonimidoyl]pyrrolidine-1-carbonyl]-4,6,6-trimethylheptanoate |
| SMILES | C=CC1CC1(C)/N=C(\C)C1CCCN1C(=O)C(C(C)CCC(=O)OCCCC(C)CC)C(C)(C)C |
| InChI | InChI=1S/C30H52N2O3/c1-10-21(3)14-13-19-35-26(33)17-16-22(4)27(29(6,7)8)28(34)32-18-12-15-25(32)23(5)31-30(9)20-24(30)11-2/h11,21-22,24-25,27H,2,10,12-20H2,1,3-9H3/b31-23+ |
| InChIKey | URNZHADJIHYXLD-UQRQXUALSA-N |
| XLogP | 6.85 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|