C30H51NO3 — CID 123777186
hex-4-enyl 6-[2-[3-(2-ethenyl-1-methylcyclopropyl)propyl]pyrrolidine-1-carbonyl]-7,7-dimethyloctanoate (PubChem CID 123777186) has the molecular formula C30H51NO3 and a molecular weight of 473.74 g/mol. Its IUPAC name is hex-4-enyl 6-[2-[3-(2-ethenyl-1-methylcyclopropyl)propyl]pyrrolidine-1-carbonyl]-7,7-dimethyloctanoate.
| Compound Name | hex-4-enyl 6-[2-[3-(2-ethenyl-1-methylcyclopropyl)propyl]pyrrolidine-1-carbonyl]-7,7-dimethyloctanoate |
|---|---|
| PubChem CID | 123777186 |
| Molecular Formula | C30H51NO3 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.39 |
| IUPAC Name | hex-4-enyl 6-[2-[3-(2-ethenyl-1-methylcyclopropyl)propyl]pyrrolidine-1-carbonyl]-7,7-dimethyloctanoate |
| SMILES | C=CC1CC1(C)CCCC1CCCN1C(=O)C(CCCCC(=O)OCCCC=CC)C(C)(C)C |
| InChI | InChI=1S/C30H51NO3/c1-7-9-10-13-22-34-27(32)19-12-11-18-26(29(3,4)5)28(33)31-21-15-17-25(31)16-14-20-30(6)23-24(30)8-2/h7-9,24-26H,2,10-23H2,1,3-6H3 |
| InChIKey | DRBOVNNYYQLNKS-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|