C26H45NO2 — CID 88825258
ethyl 7-[(1R,5R)-5-[(E)-oct-1-enyl]-2-pyrrolidin-1-ylcyclopent-2-en-1-yl]heptanoate (PubChem CID 88825258) has the molecular formula C26H45NO2 and a molecular weight of 403.65 g/mol. Its IUPAC name is ethyl 7-[(1R,5R)-5-[(E)-oct-1-enyl]-2-pyrrolidin-1-ylcyclopent-2-en-1-yl]heptanoate.
| Compound Name | ethyl 7-[(1R,5R)-5-[(E)-oct-1-enyl]-2-pyrrolidin-1-ylcyclopent-2-en-1-yl]heptanoate |
|---|---|
| PubChem CID | 88825258 |
| Molecular Formula | C26H45NO2 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 403.35 |
| IUPAC Name | ethyl 7-[(1R,5R)-5-[(E)-oct-1-enyl]-2-pyrrolidin-1-ylcyclopent-2-en-1-yl]heptanoate |
| SMILES | CCCCCC/C=C/[C@H]1CC=C(N2CCCC2)[C@@H]1CCCCCCC(=O)OCC |
| InChI | InChI=1S/C26H45NO2/c1-3-5-6-7-8-11-16-23-19-20-25(27-21-14-15-22-27)24(23)17-12-9-10-13-18-26(28)29-4-2/h11,16,20,23-24H,3-10,12-15,17-19,21-22H2,1-2H3/b16-11+/t23-,24+/m0/s1 |
| InChIKey | LAICXRCBADOKGS-ZWNAOCHBSA-N |
| XLogP | 7.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|