C22H37NO2 — CID 134979914
ethyl (1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate (PubChem CID 134979914) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is ethyl (1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134979914 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | ethyl (1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(N2CCCC2)C=CC[C@@H]1CC(C)CCC=C(C)C |
| InChI | InChI=1S/C22H37NO2/c1-5-25-22(24)21-19(16-18(4)11-8-10-17(2)3)12-9-13-20(21)23-14-6-7-15-23/h9-10,13,18-21H,5-8,11-12,14-16H2,1-4H3/t18?,19-,20?,21-/m1/s1 |
| InChIKey | HLGASKBMOZETOX-GOLJUSPKSA-N |
| XLogP | 4.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|