C22H34N2O2 — CID 134980508
ethyl (1S,6S)-1-cyano-5,6-dimethyl-6-(3-methylpent-4-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate (PubChem CID 134980508) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is ethyl (1S,6S)-1-cyano-5,6-dimethyl-6-(3-methylpent-4-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,6S)-1-cyano-5,6-dimethyl-6-(3-methylpent-4-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134980508 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | ethyl (1S,6S)-1-cyano-5,6-dimethyl-6-(3-methylpent-4-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate |
| SMILES | C=CC(C)CC[C@@]1(C)C(C)C=CC(N2CCCC2)[C@@]1(C#N)C(=O)OCC |
| InChI | InChI=1S/C22H34N2O2/c1-6-17(3)12-13-21(5)18(4)10-11-19(24-14-8-9-15-24)22(21,16-23)20(25)26-7-2/h6,10-11,17-19H,1,7-9,12-15H2,2-5H3/t17?,18?,19?,21-,22-/m0/s1 |
| InChIKey | MLVJRQVIVCKUCF-QGSFHLTQSA-N |
| XLogP | 4.34 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|