C21H32N2O2 — CID 134980507
ethyl (1S,6S)-1-cyano-6-methyl-6-(3-methylpent-4-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate (PubChem CID 134980507) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is ethyl (1S,6S)-1-cyano-6-methyl-6-(3-methylpent-4-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,6S)-1-cyano-6-methyl-6-(3-methylpent-4-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134980507 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | ethyl (1S,6S)-1-cyano-6-methyl-6-(3-methylpent-4-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate |
| SMILES | C=CC(C)CC[C@@]1(C)CC=CC(N2CCCC2)[C@@]1(C#N)C(=O)OCC |
| InChI | InChI=1S/C21H32N2O2/c1-5-17(3)11-13-20(4)12-9-10-18(23-14-7-8-15-23)21(20,16-22)19(24)25-6-2/h5,9-10,17-18H,1,6-8,11-15H2,2-4H3/t17?,18?,20-,21+/m1/s1 |
| InChIKey | JSMRWZXGMZFDRI-FMFRFZGHSA-N |
| XLogP | 4.09 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|