C21H34N2O2 — CID 134979744
ethyl (1S,6S)-1-cyano-5,6-dimethyl-6-pentyl-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate (PubChem CID 134979744) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is ethyl (1S,6S)-1-cyano-5,6-dimethyl-6-pentyl-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,6S)-1-cyano-5,6-dimethyl-6-pentyl-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134979744 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | ethyl (1S,6S)-1-cyano-5,6-dimethyl-6-pentyl-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate |
| SMILES | CCCCC[C@@]1(C)C(C)C=CC(N2CCCC2)[C@@]1(C#N)C(=O)OCC |
| InChI | InChI=1S/C21H34N2O2/c1-5-7-8-13-20(4)17(3)11-12-18(23-14-9-10-15-23)21(20,16-22)19(24)25-6-2/h11-12,17-18H,5-10,13-15H2,1-4H3/t17?,18?,20-,21-/m0/s1 |
| InChIKey | DMLCDLBWSDEEFU-RQWVFBBXSA-N |
| XLogP | 4.32 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|