C21H35NO2 — CID 134980404
methyl (1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate (PubChem CID 134980404) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is methyl (1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134980404 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | methyl (1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1C(N2CCCC2)C=CC[C@@H]1CC(C)CCC=C(C)C |
| InChI | InChI=1S/C21H35NO2/c1-16(2)9-7-10-17(3)15-18-11-8-12-19(20(18)21(23)24-4)22-13-5-6-14-22/h8-9,12,17-20H,5-7,10-11,13-15H2,1-4H3/t17?,18-,19?,20-/m1/s1 |
| InChIKey | OECQUCVOYBCKBE-CQJJOKNBSA-N |
| XLogP | 4.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|