C17H25NO2 — CID 86277855
(4R,5R)-5-[(1S)-1-(1,2,3,5,6,7-hexahydroindolizin-8-yl)but-3-enyl]-4-methyloxolan-2-one (PubChem CID 86277855) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (4R,5R)-5-[(1S)-1-(1,2,3,5,6,7-hexahydroindolizin-8-yl)but-3-enyl]-4-methyloxolan-2-one.
| Compound Name | (4R,5R)-5-[(1S)-1-(1,2,3,5,6,7-hexahydroindolizin-8-yl)but-3-enyl]-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 86277855 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (4R,5R)-5-[(1S)-1-(1,2,3,5,6,7-hexahydroindolizin-8-yl)but-3-enyl]-4-methyloxolan-2-one |
| SMILES | C=CC[C@@H](C1=C2CCCN2CCC1)[C@@H]1OC(=O)C[C@H]1C |
| InChI | InChI=1S/C17H25NO2/c1-3-6-14(17-12(2)11-16(19)20-17)13-7-4-9-18-10-5-8-15(13)18/h3,12,14,17H,1,4-11H2,2H3/t12-,14+,17-/m1/s1 |
| InChIKey | XZEGKROVJUHLDH-HACGYAERSA-N |
| XLogP | 3.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|