About 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline
3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline (PubChem CID 123448711) has the molecular formula C9H12F3NS3
and a molecular weight of 287.40 g/mol. Its IUPAC name is 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline |
| PubChem CID | 123448711 |
| Molecular Formula | C9H12F3NS3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline |
| SMILES | CS(C)(S)Sc1cccc(N)c1C(F)(F)F |
| InChI | InChI=1S/C9H12F3NS3/c1-16(2,14)15-7-5-3-4-6(13)8(7)9(10,11)12/h3-5,14H,13H2,1-2H3 |
| InChIKey | FDASMCHVYTXDQJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline?
The IUPAC name of 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline (CID 123448711) is 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline.
What is the SMILES notation for 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline?
The canonical SMILES for 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline is CS(C)(S)Sc1cccc(N)c1C(F)(F)F.
What is the InChIKey of 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline?
The InChIKey is FDASMCHVYTXDQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NS3/c1-16(2,14)15-7-5-3-4-6(13)8(7)9(10,11)12/h3-5,14H,13H2,1-2H3.
What are the key properties of 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline?
3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline has a molecular weight of 287.40 g/mol, XLogP of 4.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[dimethyl(sulfanyl)-λ4-sulfanyl]sulfanyl-2-(trifluoromethyl)aniline is sourced from PubChem (CID 123448711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).