C13H17N3 — CID 123449068
(6E)-8-(5-iminopent-1-ynyl)-4-methyl-4,5-dihydro-2H-azocin-3-imine (PubChem CID 123449068) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is (6E)-8-(5-iminopent-1-ynyl)-4-methyl-4,5-dihydro-2H-azocin-3-imine.
| Compound Name | (6E)-8-(5-iminopent-1-ynyl)-4-methyl-4,5-dihydro-2H-azocin-3-imine |
|---|---|
| PubChem CID | 123449068 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (6E)-8-(5-iminopent-1-ynyl)-4-methyl-4,5-dihydro-2H-azocin-3-imine |
| SMILES | [H]/N=C1\C/N=C(C#CCC/C=N/[H])\C=C/CC1C |
| InChI | InChI=1S/C13H17N3/c1-11-6-5-8-12(16-10-13(11)15)7-3-2-4-9-14/h5,8-9,11,14-15H,2,4,6,10H2,1H3/b8-5-,14-9+,15-13+,16-12- |
| InChIKey | KIAZPSTZVSVVJX-UYVSKGTESA-N |
| XLogP | 2.48 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|