C23H26N2 — CID 123394806
3-methyl-7-[3-(2-methylcycloocta-2,4-dien-7-yn-1-yl)prop-1-enylidene]-6-methylidenenona-2,4-diene-1,8-diimine (PubChem CID 123394806) has the molecular formula C23H26N2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 3-methyl-7-[3-(2-methylcycloocta-2,4-dien-7-yn-1-yl)prop-1-enylidene]-6-methylidenenona-2,4-diene-1,8-diimine.
| Compound Name | 3-methyl-7-[3-(2-methylcycloocta-2,4-dien-7-yn-1-yl)prop-1-enylidene]-6-methylidenenona-2,4-diene-1,8-diimine |
|---|---|
| PubChem CID | 123394806 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 3-methyl-7-[3-(2-methylcycloocta-2,4-dien-7-yn-1-yl)prop-1-enylidene]-6-methylidenenona-2,4-diene-1,8-diimine |
| SMILES | [H]/N=C/C=C(C)C=CC(=C)C(=C=CCC1C#CCC=CC=C1C)/C(C)=N/[H] |
| InChI | InChI=1S/C23H26N2/c1-18(16-17-24)14-15-20(3)23(21(4)25)13-9-12-22-11-8-6-5-7-10-19(22)2/h5,7,9-10,14-17,22,24-25H,3,6,12H2,1-2,4H3/b7-5?,15-14?,18-16?,19-10?,24-17+,25-21+ |
| InChIKey | JMQYWNJXTGILTN-KYPVIOAKSA-N |
| XLogP | 5.73 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|