C17H24N2 — CID 123416375
2-[(1E,4Z,6Z)-2,5-dimethyl-3-methylidenedeca-1,4,6,9-tetraenyl]butane-1,3-diimine (PubChem CID 123416375) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-[(1E,4Z,6Z)-2,5-dimethyl-3-methylidenedeca-1,4,6,9-tetraenyl]butane-1,3-diimine.
| Compound Name | 2-[(1E,4Z,6Z)-2,5-dimethyl-3-methylidenedeca-1,4,6,9-tetraenyl]butane-1,3-diimine |
|---|---|
| PubChem CID | 123416375 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-[(1E,4Z,6Z)-2,5-dimethyl-3-methylidenedeca-1,4,6,9-tetraenyl]butane-1,3-diimine |
| SMILES | [H]/N=C/C(/C=C(\C)C(=C)/C=C(C)\C=C/CC=C)/C(C)=N/[H] |
| InChI | InChI=1S/C17H24N2/c1-6-7-8-9-13(2)10-14(3)15(4)11-17(12-18)16(5)19/h6,8-12,17-19H,1,3,7H2,2,4-5H3/b9-8-,13-10-,15-11+,18-12+,19-16+ |
| InChIKey | YFMBQTPTGHZKKA-NXWDPIGLSA-N |
| XLogP | 4.87 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|