C7H8N2 — CID 166176910
6-methanimidoylcyclohexa-2,4-dien-1-imine (PubChem CID 166176910) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is 6-methanimidoylcyclohexa-2,4-dien-1-imine.
| Compound Name | 6-methanimidoylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 166176910 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 6-methanimidoylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C1C=CC=C/C1=N\[H] |
| InChI | InChI=1S/C7H8N2/c8-5-6-3-1-2-4-7(6)9/h1-6,8-9H/b8-5+,9-7+ |
| InChIKey | FKSXVDZLKAHZEX-OCIXRKKMSA-N |
| XLogP | 1.40 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|