C16H31N3 — CID 123449807
N-methyl-8-(5-methylheptan-2-ylideneamino)-1,2,3,4,5,8-hexahydroazocin-4-amine (PubChem CID 123449807) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is N-methyl-8-(5-methylheptan-2-ylideneamino)-1,2,3,4,5,8-hexahydroazocin-4-amine.
| Compound Name | N-methyl-8-(5-methylheptan-2-ylideneamino)-1,2,3,4,5,8-hexahydroazocin-4-amine |
|---|---|
| PubChem CID | 123449807 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | N-methyl-8-(5-methylheptan-2-ylideneamino)-1,2,3,4,5,8-hexahydroazocin-4-amine |
| SMILES | CCC(C)CCC(C)=NC1C=CCC(NC)CCN1 |
| InChI | InChI=1S/C16H31N3/c1-5-13(2)9-10-14(3)19-16-8-6-7-15(17-4)11-12-18-16/h6,8,13,15-18H,5,7,9-12H2,1-4H3 |
| InChIKey | CKNQFMHQZJLWPN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|