C26H36N5O5SSi — CID 123450528
CID 123450528 (PubChem CID 123450528) has the molecular formula C26H36N5O5SSi and a molecular weight of 558.76 g/mol.
| Compound Name | CID 123450528 |
|---|---|
| PubChem CID | 123450528 |
| Molecular Formula | C26H36N5O5SSi |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | — |
| SMILES | CN(CCCO[Si](C)C(C)(C)C)c1nccc2oc(-c3cnc4ccc(OCCCS(C)(=O)=O)nn34)cc12 |
| InChI | InChI=1S/C26H36N5O5SSi/c1-26(2,3)38(6)35-15-7-13-30(4)25-19-17-22(36-21(19)11-12-27-25)20-18-28-23-9-10-24(29-31(20)23)34-14-8-16-37(5,32)33/h9-12,17-18H,7-8,13-16H2,1-6H3 |
| InChIKey | DKYZNGFTHAJNGB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|