C12H21NSi — CID 123450805
1,2,4-tris(prop-1-enyl)azasilolidine (PubChem CID 123450805) has the molecular formula C12H21NSi and a molecular weight of 207.39 g/mol. Its IUPAC name is 1,2,4-tris(prop-1-enyl)azasilolidine.
| Compound Name | 1,2,4-tris(prop-1-enyl)azasilolidine |
|---|---|
| PubChem CID | 123450805 |
| Molecular Formula | C12H21NSi |
| Molecular Weight | 207.39 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1,2,4-tris(prop-1-enyl)azasilolidine |
| SMILES | CC=CC1CN(C=CC)[SiH](C=CC)C1 |
| InChI | InChI=1S/C12H21NSi/c1-4-7-12-10-13(8-5-2)14(11-12)9-6-3/h4-9,12,14H,10-11H2,1-3H3 |
| InChIKey | LKMQMTRZZCNJIP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|