C41H66N2O6 — CID 123450827
methyl N-[2-[19-[4-(2-cyclopropylacetyl)morpholin-2-yl]oxy-5,18,18-trimethyl-10-oxahexacyclo[12.10.1.11,23.05,13.06,11.017,23]hexacosan-9-yl]ethyl]carbamate (PubChem CID 123450827) has the molecular formula C41H66N2O6 and a molecular weight of 682.99 g/mol. Its IUPAC name is methyl N-[2-[19-[4-(2-cyclopropylacetyl)morpholin-2-yl]oxy-5,18,18-trimethyl-10-oxahexacyclo[12.10.1.11,23.05,13.06,11.017,23]hexacosan-9-yl]ethyl]carbamate.
| Compound Name | methyl N-[2-[19-[4-(2-cyclopropylacetyl)morpholin-2-yl]oxy-5,18,18-trimethyl-10-oxahexacyclo[12.10.1.11,23.05,13.06,11.017,23]hexacosan-9-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 123450827 |
| Molecular Formula | C41H66N2O6 |
| Molecular Weight | 682.99 g/mol |
| Exact Mass | 682.49 |
| IUPAC Name | methyl N-[2-[19-[4-(2-cyclopropylacetyl)morpholin-2-yl]oxy-5,18,18-trimethyl-10-oxahexacyclo[12.10.1.11,23.05,13.06,11.017,23]hexacosan-9-yl]ethyl]carbamate |
| SMILES | COC(=O)NCCC1CCC2C(CC3C4CCC5C6(CCCC(OC7CN(C(=O)CC8CC8)CCO7)C5(C)C)CC(CCCC32C)(C4)C6)O1 |
| InChI | InChI=1S/C41H66N2O6/c1-38(2)33-13-10-28-23-40(16-6-15-39(3)30-12-11-29(14-18-42-37(45)46-4)48-32(30)22-31(28)39)25-41(33,26-40)17-5-7-34(38)49-36-24-43(19-20-47-36)35(44)21-27-8-9-27/h27-34,36H,5-26H2,1-4H3,(H,42,45) |
| InChIKey | GJRSKFPUFRNCJP-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.99 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |