C39H61NO5 — CID 123589216
19-[4-(2-cyclopropylacetyl)morpholin-2-yl]oxy-7-ethyl-5,18,18-trimethyl-10-oxahexacyclo[21.1.1.01,14.05,13.06,11.017,23]pentacosane-9-carbaldehyde (PubChem CID 123589216) has the molecular formula C39H61NO5 and a molecular weight of 623.92 g/mol. Its IUPAC name is 19-[4-(2-cyclopropylacetyl)morpholin-2-yl]oxy-7-ethyl-5,18,18-trimethyl-10-oxahexacyclo[21.1.1.01,14.05,13.06,11.017,23]pentacosane-9-carbaldehyde.
| Compound Name | 19-[4-(2-cyclopropylacetyl)morpholin-2-yl]oxy-7-ethyl-5,18,18-trimethyl-10-oxahexacyclo[21.1.1.01,14.05,13.06,11.017,23]pentacosane-9-carbaldehyde |
|---|---|
| PubChem CID | 123589216 |
| Molecular Formula | C39H61NO5 |
| Molecular Weight | 623.92 g/mol |
| Exact Mass | 623.45 |
| IUPAC Name | 19-[4-(2-cyclopropylacetyl)morpholin-2-yl]oxy-7-ethyl-5,18,18-trimethyl-10-oxahexacyclo[21.1.1.01,14.05,13.06,11.017,23]pentacosane-9-carbaldehyde |
| SMILES | CCC1CC(C=O)OC2CC3C4CCC5C6(CCCC(OC7CN(C(=O)CC8CC8)CCO7)C5(C)C)CC4(CCCC3(C)C12)C6 |
| InChI | InChI=1S/C39H61NO5/c1-5-26-19-27(22-41)44-30-20-29-28-11-12-31-36(2,3)32(45-34-21-40(16-17-43-34)33(42)18-25-9-10-25)8-6-14-39(31)23-38(28,24-39)15-7-13-37(29,4)35(26)30/h22,25-32,34-35H,5-21,23-24H2,1-4H3 |
| InChIKey | YOGZNEKXWDLZOM-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.92 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|