C26H27FN4O5S2 — CID 123451263
4-[4-[[2-[2-(1-fluoroethyl)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]-6-methoxy-1-benzofuran-4-yl]oxymethyl]-1,3-thiazol-2-yl]-2,6-dimethyloxan-4-ol (PubChem CID 123451263) has the molecular formula C26H27FN4O5S2 and a molecular weight of 558.66 g/mol. Its IUPAC name is 4-[4-[[2-[2-(1-fluoroethyl)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]-6-methoxy-1-benzofuran-4-yl]oxymethyl]-1,3-thiazol-2-yl]-2,6-dimethyloxan-4-ol.
| Compound Name | 4-[4-[[2-[2-(1-fluoroethyl)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]-6-methoxy-1-benzofuran-4-yl]oxymethyl]-1,3-thiazol-2-yl]-2,6-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 123451263 |
| Molecular Formula | C26H27FN4O5S2 |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 4-[4-[[2-[2-(1-fluoroethyl)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]-6-methoxy-1-benzofuran-4-yl]oxymethyl]-1,3-thiazol-2-yl]-2,6-dimethyloxan-4-ol |
| SMILES | COc1cc(OCc2csc(C3(O)CC(C)OC(C)C3)n2)c2cc(-c3cn4nc(C(C)F)sc4n3)oc2c1 |
| InChI | InChI=1S/C26H27FN4O5S2/c1-13-8-26(32,9-14(2)35-13)24-28-16(12-37-24)11-34-20-5-17(33-4)6-21-18(20)7-22(36-21)19-10-31-25(29-19)38-23(30-31)15(3)27/h5-7,10,12-15,32H,8-9,11H2,1-4H3 |
| InChIKey | PWNJFOJOEMZUPR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |