C24H25FN4O4S2 — CID 146232206
2-ethyl-6-[4-[[2-(4-fluorooxan-4-yl)-1,3-thiazol-4-yl]methoxy]-6-methoxy-1-benzofuran-2-yl]-2,3-dihydroimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 146232206) has the molecular formula C24H25FN4O4S2 and a molecular weight of 516.62 g/mol. Its IUPAC name is 2-ethyl-6-[4-[[2-(4-fluorooxan-4-yl)-1,3-thiazol-4-yl]methoxy]-6-methoxy-1-benzofuran-2-yl]-2,3-dihydroimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2-ethyl-6-[4-[[2-(4-fluorooxan-4-yl)-1,3-thiazol-4-yl]methoxy]-6-methoxy-1-benzofuran-2-yl]-2,3-dihydroimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 146232206 |
| Molecular Formula | C24H25FN4O4S2 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 2-ethyl-6-[4-[[2-(4-fluorooxan-4-yl)-1,3-thiazol-4-yl]methoxy]-6-methoxy-1-benzofuran-2-yl]-2,3-dihydroimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | CCC1Nn2cc(-c3cc4c(OCc5csc(C6(F)CCOCC6)n5)cc(OC)cc4o3)nc2S1 |
| InChI | InChI=1S/C24H25FN4O4S2/c1-3-21-28-29-11-17(27-23(29)35-21)20-10-16-18(8-15(30-2)9-19(16)33-20)32-12-14-13-34-22(26-14)24(25)4-6-31-7-5-24/h8-11,13,21,28H,3-7,12H2,1-2H3 |
| InChIKey | RTWUQXANLSURFF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |