C21H19ClF4N6O2 — CID 123451792
N-[(4-chloro-3-fluorophenyl)-(1,3-oxazol-5-yl)methyl]-2-(1,1,1-trifluoropropan-2-ylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide (PubChem CID 123451792) has the molecular formula C21H19ClF4N6O2 and a molecular weight of 498.87 g/mol. Its IUPAC name is N-[(4-chloro-3-fluorophenyl)-(1,3-oxazol-5-yl)methyl]-2-(1,1,1-trifluoropropan-2-ylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide.
| Compound Name | N-[(4-chloro-3-fluorophenyl)-(1,3-oxazol-5-yl)methyl]-2-(1,1,1-trifluoropropan-2-ylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 123451792 |
| Molecular Formula | C21H19ClF4N6O2 |
| Molecular Weight | 498.87 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | N-[(4-chloro-3-fluorophenyl)-(1,3-oxazol-5-yl)methyl]-2-(1,1,1-trifluoropropan-2-ylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide |
| SMILES | CC(Nc1ncc2c(n1)CN(C(=O)NC(c1ccc(Cl)c(F)c1)c1cnco1)CC2)C(F)(F)F |
| InChI | InChI=1S/C21H19ClF4N6O2/c1-11(21(24,25)26)29-19-28-7-13-4-5-32(9-16(13)30-19)20(33)31-18(17-8-27-10-34-17)12-2-3-14(22)15(23)6-12/h2-3,6-8,10-11,18H,4-5,9H2,1H3,(H,31,33)(H,28,29,30) |
| InChIKey | QKKKHAYHKWYVMR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |