C17H15FN2O2 — CID 123452237
6-(3,5-dimethoxyphenyl)-8-fluoro-2-methylquinazoline (PubChem CID 123452237) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is 6-(3,5-dimethoxyphenyl)-8-fluoro-2-methylquinazoline.
| Compound Name | 6-(3,5-dimethoxyphenyl)-8-fluoro-2-methylquinazoline |
|---|---|
| PubChem CID | 123452237 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 6-(3,5-dimethoxyphenyl)-8-fluoro-2-methylquinazoline |
| SMILES | COc1cc(OC)cc(-c2cc(F)c3nc(C)ncc3c2)c1 |
| InChI | InChI=1S/C17H15FN2O2/c1-10-19-9-13-4-11(7-16(18)17(13)20-10)12-5-14(21-2)8-15(6-12)22-3/h4-9H,1-3H3 |
| InChIKey | RSGIOIJTTWNMNO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |